C24H24N4O2 — CID 122285167
N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-4-pentoxybenzamide (PubChem CID 122285167) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-4-pentoxybenzamide.
| Compound Name | N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-4-pentoxybenzamide |
|---|---|
| PubChem CID | 122285167 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)Nc2cccc(-c3cn4cccnc4n3)c2)cc1 |
| InChI | InChI=1S/C24H24N4O2/c1-2-3-4-15-30-21-11-9-18(10-12-21)23(29)26-20-8-5-7-19(16-20)22-17-28-14-6-13-25-24(28)27-22/h5-14,16-17H,2-4,15H2,1H3,(H,26,29) |
| InChIKey | GRWZXNSOTKJDTD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|