C22H20N4O3 — CID 122283501
1-(2,3-dimethoxyphenyl)-3-(3-imidazo[1,2-a]pyridin-2-ylphenyl)urea (PubChem CID 122283501) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 1-(2,3-dimethoxyphenyl)-3-(3-imidazo[1,2-a]pyridin-2-ylphenyl)urea.
| Compound Name | 1-(2,3-dimethoxyphenyl)-3-(3-imidazo[1,2-a]pyridin-2-ylphenyl)urea |
|---|---|
| PubChem CID | 122283501 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1-(2,3-dimethoxyphenyl)-3-(3-imidazo[1,2-a]pyridin-2-ylphenyl)urea |
| SMILES | COc1cccc(NC(=O)Nc2cccc(-c3cn4ccccc4n3)c2)c1OC |
| InChI | InChI=1S/C22H20N4O3/c1-28-19-10-6-9-17(21(19)29-2)25-22(27)23-16-8-5-7-15(13-16)18-14-26-12-4-3-11-20(26)24-18/h3-14H,1-2H3,(H2,23,25,27) |
| InChIKey | MKFZVVAHOWGCAH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |