C18H19N3O — CID 845423
N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)-3-methylbutanamide (PubChem CID 845423) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)-3-methylbutanamide.
| Compound Name | N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 845423 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1cccc(-c2cn3ccccc3n2)c1 |
| InChI | InChI=1S/C18H19N3O/c1-13(2)10-18(22)19-15-7-5-6-14(11-15)16-12-21-9-4-3-8-17(21)20-16/h3-9,11-13H,10H2,1-2H3,(H,19,22) |
| InChIKey | CCMKHJVJZUNKRF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |