C18H15N3O3 — CID 4846463
N-(3-acetylphenyl)-4-[(2-cyanoacetyl)amino]benzamide (PubChem CID 4846463) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is N-(3-acetylphenyl)-4-[(2-cyanoacetyl)amino]benzamide.
| Compound Name | N-(3-acetylphenyl)-4-[(2-cyanoacetyl)amino]benzamide |
|---|---|
| PubChem CID | 4846463 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-(3-acetylphenyl)-4-[(2-cyanoacetyl)amino]benzamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2ccc(NC(=O)CC#N)cc2)c1 |
| InChI | InChI=1S/C18H15N3O3/c1-12(22)14-3-2-4-16(11-14)21-18(24)13-5-7-15(8-6-13)20-17(23)9-10-19/h2-8,11H,9H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | XIMLHBLZBJHQCJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |