C18H17N3O4 — CID 108922675
N-[3-[(2-cyanoacetyl)amino]phenyl]-3,5-dimethoxybenzamide (PubChem CID 108922675) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is N-[3-[(2-cyanoacetyl)amino]phenyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[3-[(2-cyanoacetyl)amino]phenyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 108922675 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-[3-[(2-cyanoacetyl)amino]phenyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2cccc(NC(=O)CC#N)c2)c1 |
| InChI | InChI=1S/C18H17N3O4/c1-24-15-8-12(9-16(11-15)25-2)18(23)21-14-5-3-4-13(10-14)20-17(22)6-7-19/h3-5,8-11H,6H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | FXEKCBWPJFMYNX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |