C9H8N2O2 — CID 22099165
2-cyano-N-(3-hydroxyphenyl)acetamide (PubChem CID 22099165) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 2-cyano-N-(3-hydroxyphenyl)acetamide.
| Compound Name | 2-cyano-N-(3-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 22099165 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 2-cyano-N-(3-hydroxyphenyl)acetamide |
| SMILES | N#CCC(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C9H8N2O2/c10-5-4-9(13)11-7-2-1-3-8(12)6-7/h1-3,6,12H,4H2,(H,11,13) |
| InChIKey | ZGBKOOIUDOQCKA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |