C18H16N2O2 — CID 168520748
2-cyano-N-[3-(3,4-dimethylbenzoyl)phenyl]acetamide (PubChem CID 168520748) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-cyano-N-[3-(3,4-dimethylbenzoyl)phenyl]acetamide.
| Compound Name | 2-cyano-N-[3-(3,4-dimethylbenzoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 168520748 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-cyano-N-[3-(3,4-dimethylbenzoyl)phenyl]acetamide |
| SMILES | Cc1ccc(C(=O)c2cccc(NC(=O)CC#N)c2)cc1C |
| InChI | InChI=1S/C18H16N2O2/c1-12-6-7-15(10-13(12)2)18(22)14-4-3-5-16(11-14)20-17(21)8-9-19/h3-7,10-11H,8H2,1-2H3,(H,20,21) |
| InChIKey | ACDMSJMVDKUSBZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |