C10H9FN2O — CID 24693898
2-cyano-N-(3-fluoro-4-methylphenyl)acetamide (PubChem CID 24693898) has the molecular formula C10H9FN2O and a molecular weight of 192.19 g/mol. Its IUPAC name is 2-cyano-N-(3-fluoro-4-methylphenyl)acetamide.
| Compound Name | 2-cyano-N-(3-fluoro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 24693898 |
| Molecular Formula | C10H9FN2O |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 2-cyano-N-(3-fluoro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CC#N)cc1F |
| InChI | InChI=1S/C10H9FN2O/c1-7-2-3-8(6-9(7)11)13-10(14)4-5-12/h2-3,6H,4H2,1H3,(H,13,14) |
| InChIKey | NWSWPZAGHNBJIF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |