C19H19N3O2 — CID 108924079
N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]-3,4-dimethylbenzamide (PubChem CID 108924079) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]-3,4-dimethylbenzamide.
| Compound Name | N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 108924079 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCc2cccc(NC(=O)CC#N)c2)cc1C |
| InChI | InChI=1S/C19H19N3O2/c1-13-6-7-16(10-14(13)2)19(24)21-12-15-4-3-5-17(11-15)22-18(23)8-9-20/h3-7,10-11H,8,12H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | KBEPHHOKACXCOW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |