C17H12F3N3O2 — CID 108924063
N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]-2,3,4-trifluorobenzamide (PubChem CID 108924063) has the molecular formula C17H12F3N3O2 and a molecular weight of 347.30 g/mol. Its IUPAC name is N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 108924063 |
| Molecular Formula | C17H12F3N3O2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]-2,3,4-trifluorobenzamide |
| SMILES | N#CCC(=O)Nc1cccc(CNC(=O)c2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C17H12F3N3O2/c18-13-5-4-12(15(19)16(13)20)17(25)22-9-10-2-1-3-11(8-10)23-14(24)6-7-21/h1-5,8H,6,9H2,(H,22,25)(H,23,24) |
| InChIKey | PYSSHYGRWVYLGP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|