C15H13N5O2 — CID 108924075
N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]pyrazine-2-carboxamide (PubChem CID 108924075) has the molecular formula C15H13N5O2 and a molecular weight of 295.30 g/mol. Its IUPAC name is N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]pyrazine-2-carboxamide.
| Compound Name | N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 108924075 |
| Molecular Formula | C15H13N5O2 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-[[3-[(2-cyanoacetyl)amino]phenyl]methyl]pyrazine-2-carboxamide |
| SMILES | N#CCC(=O)Nc1cccc(CNC(=O)c2cnccn2)c1 |
| InChI | InChI=1S/C15H13N5O2/c16-5-4-14(21)20-12-3-1-2-11(8-12)9-19-15(22)13-10-17-6-7-18-13/h1-3,6-8,10H,4,9H2,(H,19,22)(H,20,21) |
| InChIKey | ZXJLWLBKUFYMRT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |