C15H10F3NO3 — CID 84761710
3-[[(2,3,4-trifluorobenzoyl)amino]methyl]benzoic acid (PubChem CID 84761710) has the molecular formula C15H10F3NO3 and a molecular weight of 309.24 g/mol. Its IUPAC name is 3-[[(2,3,4-trifluorobenzoyl)amino]methyl]benzoic acid.
| Compound Name | 3-[[(2,3,4-trifluorobenzoyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 84761710 |
| Molecular Formula | C15H10F3NO3 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 3-[[(2,3,4-trifluorobenzoyl)amino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNC(=O)c2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C15H10F3NO3/c16-11-5-4-10(12(17)13(11)18)14(20)19-7-8-2-1-3-9(6-8)15(21)22/h1-6H,7H2,(H,19,20)(H,21,22) |
| InChIKey | TWFGIQCHXNHOBX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|