C17H12F3NO4 — CID 178053092
3-[[[2-formyl-4-(trifluoromethyl)benzoyl]amino]methyl]benzoic acid (PubChem CID 178053092) has the molecular formula C17H12F3NO4 and a molecular weight of 351.28 g/mol. Its IUPAC name is 3-[[[2-formyl-4-(trifluoromethyl)benzoyl]amino]methyl]benzoic acid.
| Compound Name | 3-[[[2-formyl-4-(trifluoromethyl)benzoyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 178053092 |
| Molecular Formula | C17H12F3NO4 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 3-[[[2-formyl-4-(trifluoromethyl)benzoyl]amino]methyl]benzoic acid |
| SMILES | O=Cc1cc(C(F)(F)F)ccc1C(=O)NCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H12F3NO4/c18-17(19,20)13-4-5-14(12(7-13)9-22)15(23)21-8-10-2-1-3-11(6-10)16(24)25/h1-7,9H,8H2,(H,21,23)(H,24,25) |
| InChIKey | AZUUSFWOZMQQSB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|