C14H12F3N3O3 — CID 91644944
3-[[[1-methyl-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]methyl]benzoic acid (PubChem CID 91644944) has the molecular formula C14H12F3N3O3 and a molecular weight of 327.26 g/mol. Its IUPAC name is 3-[[[1-methyl-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 3-[[[1-methyl-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 91644944 |
| Molecular Formula | C14H12F3N3O3 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 3-[[[1-methyl-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]methyl]benzoic acid |
| SMILES | Cn1cc(C(=O)NCc2cccc(C(=O)O)c2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H12F3N3O3/c1-20-7-10(11(19-20)14(15,16)17)12(21)18-6-8-3-2-4-9(5-8)13(22)23/h2-5,7H,6H2,1H3,(H,18,21)(H,22,23) |
| InChIKey | IGFJZQDAZPLLBB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |