C19H25F3N4O — CID 87008828
N-[2-(diethylamino)-3-phenylpropyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 87008828) has the molecular formula C19H25F3N4O and a molecular weight of 382.43 g/mol. Its IUPAC name is N-[2-(diethylamino)-3-phenylpropyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[2-(diethylamino)-3-phenylpropyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 87008828 |
| Molecular Formula | C19H25F3N4O |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N-[2-(diethylamino)-3-phenylpropyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CCN(CC)C(CNC(=O)c1cn(C)nc1C(F)(F)F)Cc1ccccc1 |
| InChI | InChI=1S/C19H25F3N4O/c1-4-26(5-2)15(11-14-9-7-6-8-10-14)12-23-18(27)16-13-25(3)24-17(16)19(20,21)22/h6-10,13,15H,4-5,11-12H2,1-3H3,(H,23,27) |
| InChIKey | ISSMDQGYPQBESZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |