C20H24F3N3O — CID 43067642
N-[2-(diethylamino)-3-phenylpropyl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 43067642) has the molecular formula C20H24F3N3O and a molecular weight of 379.43 g/mol. Its IUPAC name is N-[2-(diethylamino)-3-phenylpropyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[2-(diethylamino)-3-phenylpropyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 43067642 |
| Molecular Formula | C20H24F3N3O |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[2-(diethylamino)-3-phenylpropyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CCN(CC)C(CNC(=O)c1ccc(C(F)(F)F)nc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H24F3N3O/c1-3-26(4-2)17(12-15-8-6-5-7-9-15)14-25-19(27)16-10-11-18(24-13-16)20(21,22)23/h5-11,13,17H,3-4,12,14H2,1-2H3,(H,25,27) |
| InChIKey | QKOFTXRZACZRSI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |