C18H23F3N4O — CID 87008611
N-[2-(diethylamino)-2-phenylethyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 87008611) has the molecular formula C18H23F3N4O and a molecular weight of 368.40 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-phenylethyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[2-(diethylamino)-2-phenylethyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 87008611 |
| Molecular Formula | C18H23F3N4O |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-[2-(diethylamino)-2-phenylethyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CCN(CC)C(CNC(=O)c1cn(C)nc1C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C18H23F3N4O/c1-4-25(5-2)15(13-9-7-6-8-10-13)11-22-17(26)14-12-24(3)23-16(14)18(19,20)21/h6-10,12,15H,4-5,11H2,1-3H3,(H,22,26) |
| InChIKey | JMUYJBGJVBCDOP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |