C19H22BrFN2O — CID 18167188
4-bromo-N-[2-(diethylamino)-2-phenylethyl]-2-fluorobenzamide (PubChem CID 18167188) has the molecular formula C19H22BrFN2O and a molecular weight of 393.30 g/mol. Its IUPAC name is 4-bromo-N-[2-(diethylamino)-2-phenylethyl]-2-fluorobenzamide.
| Compound Name | 4-bromo-N-[2-(diethylamino)-2-phenylethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 18167188 |
| Molecular Formula | C19H22BrFN2O |
| Molecular Weight | 393.30 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 4-bromo-N-[2-(diethylamino)-2-phenylethyl]-2-fluorobenzamide |
| SMILES | CCN(CC)C(CNC(=O)c1ccc(Br)cc1F)c1ccccc1 |
| InChI | InChI=1S/C19H22BrFN2O/c1-3-23(4-2)18(14-8-6-5-7-9-14)13-22-19(24)16-11-10-15(20)12-17(16)21/h5-12,18H,3-4,13H2,1-2H3,(H,22,24) |
| InChIKey | NDSXDJSDUUMJMY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.30 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |