C11H13BrFNO3 — CID 61247809
4-bromo-N-(2,2-dimethoxyethyl)-2-fluorobenzamide (PubChem CID 61247809) has the molecular formula C11H13BrFNO3 and a molecular weight of 306.13 g/mol. Its IUPAC name is 4-bromo-N-(2,2-dimethoxyethyl)-2-fluorobenzamide.
| Compound Name | 4-bromo-N-(2,2-dimethoxyethyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 61247809 |
| Molecular Formula | C11H13BrFNO3 |
| Molecular Weight | 306.13 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 4-bromo-N-(2,2-dimethoxyethyl)-2-fluorobenzamide |
| SMILES | COC(CNC(=O)c1ccc(Br)cc1F)OC |
| InChI | InChI=1S/C11H13BrFNO3/c1-16-10(17-2)6-14-11(15)8-4-3-7(12)5-9(8)13/h3-5,10H,6H2,1-2H3,(H,14,15) |
| InChIKey | YHOADACQXKWPRU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.13 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|