C11H14BrNO4 — CID 103602044
5-bromo-N-(2,2-dimethoxyethyl)-2-hydroxybenzamide (PubChem CID 103602044) has the molecular formula C11H14BrNO4 and a molecular weight of 304.14 g/mol. Its IUPAC name is 5-bromo-N-(2,2-dimethoxyethyl)-2-hydroxybenzamide.
| Compound Name | 5-bromo-N-(2,2-dimethoxyethyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 103602044 |
| Molecular Formula | C11H14BrNO4 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 5-bromo-N-(2,2-dimethoxyethyl)-2-hydroxybenzamide |
| SMILES | COC(CNC(=O)c1cc(Br)ccc1O)OC |
| InChI | InChI=1S/C11H14BrNO4/c1-16-10(17-2)6-13-11(15)8-5-7(12)3-4-9(8)14/h3-5,10,14H,6H2,1-2H3,(H,13,15) |
| InChIKey | FYDBZGZKKDHDAH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|