C17H18BrNO5 — CID 27164512
5-bromo-2-hydroxy-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide (PubChem CID 27164512) has the molecular formula C17H18BrNO5 and a molecular weight of 396.24 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide.
| Compound Name | 5-bromo-2-hydroxy-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 27164512 |
| Molecular Formula | C17H18BrNO5 |
| Molecular Weight | 396.24 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 5-bromo-2-hydroxy-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide |
| SMILES | COc1cc(CNC(=O)c2cc(Br)ccc2O)cc(OC)c1OC |
| InChI | InChI=1S/C17H18BrNO5/c1-22-14-6-10(7-15(23-2)16(14)24-3)9-19-17(21)12-8-11(18)4-5-13(12)20/h4-8,20H,9H2,1-3H3,(H,19,21) |
| InChIKey | KPBPFAKHIQUUBP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |