C17H17BrFNO4 — CID 9483412
5-bromo-2-fluoro-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide (PubChem CID 9483412) has the molecular formula C17H17BrFNO4 and a molecular weight of 398.23 g/mol. Its IUPAC name is 5-bromo-2-fluoro-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide.
| Compound Name | 5-bromo-2-fluoro-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 9483412 |
| Molecular Formula | C17H17BrFNO4 |
| Molecular Weight | 398.23 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 5-bromo-2-fluoro-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide |
| SMILES | COc1cc(CNC(=O)c2cc(Br)ccc2F)cc(OC)c1OC |
| InChI | InChI=1S/C17H17BrFNO4/c1-22-14-6-10(7-15(23-2)16(14)24-3)9-20-17(21)12-8-11(18)4-5-13(12)19/h4-8H,9H2,1-3H3,(H,20,21) |
| InChIKey | WEGVHBFMRLVQNM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |