C16H14BrFO4 — CID 46929742
(5-bromo-2-fluorophenyl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 46929742) has the molecular formula C16H14BrFO4 and a molecular weight of 369.19 g/mol. Its IUPAC name is (5-bromo-2-fluorophenyl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (5-bromo-2-fluorophenyl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 46929742 |
| Molecular Formula | C16H14BrFO4 |
| Molecular Weight | 369.19 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | (5-bromo-2-fluorophenyl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2cc(Br)ccc2F)cc(OC)c1OC |
| InChI | InChI=1S/C16H14BrFO4/c1-20-13-6-9(7-14(21-2)16(13)22-3)15(19)11-8-10(17)4-5-12(11)18/h4-8H,1-3H3 |
| InChIKey | LDUFJQXREBCHJV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.19 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |