C20H25NO7 — CID 9483233
2,3,4-trimethoxy-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide (PubChem CID 9483233) has the molecular formula C20H25NO7 and a molecular weight of 391.42 g/mol. Its IUPAC name is 2,3,4-trimethoxy-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide.
| Compound Name | 2,3,4-trimethoxy-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 9483233 |
| Molecular Formula | C20H25NO7 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2,3,4-trimethoxy-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide |
| SMILES | COc1cc(CNC(=O)c2ccc(OC)c(OC)c2OC)cc(OC)c1OC |
| InChI | InChI=1S/C20H25NO7/c1-23-14-8-7-13(17(26-4)19(14)28-6)20(22)21-11-12-9-15(24-2)18(27-5)16(10-12)25-3/h7-10H,11H2,1-6H3,(H,21,22) |
| InChIKey | RLOZWFWDNKEONF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |