C13H19NO5 — CID 83030336
N-[(2S)-2-hydroxypropyl]-2,3,4-trimethoxybenzamide (PubChem CID 83030336) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is N-[(2S)-2-hydroxypropyl]-2,3,4-trimethoxybenzamide.
| Compound Name | N-[(2S)-2-hydroxypropyl]-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 83030336 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N-[(2S)-2-hydroxypropyl]-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC[C@H](C)O)c(OC)c1OC |
| InChI | InChI=1S/C13H19NO5/c1-8(15)7-14-13(16)9-5-6-10(17-2)12(19-4)11(9)18-3/h5-6,8,15H,7H2,1-4H3,(H,14,16)/t8-/m0/s1 |
| InChIKey | SIOLMYREIZVHLY-QMMMGPOBSA-N |
| XLogP | 0.82 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |