C14H20ClNO4 — CID 114302515
N-(3-chloro-2-methylpropyl)-2,3,4-trimethoxybenzamide (PubChem CID 114302515) has the molecular formula C14H20ClNO4 and a molecular weight of 301.77 g/mol. Its IUPAC name is N-(3-chloro-2-methylpropyl)-2,3,4-trimethoxybenzamide.
| Compound Name | N-(3-chloro-2-methylpropyl)-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 114302515 |
| Molecular Formula | C14H20ClNO4 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-(3-chloro-2-methylpropyl)-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(C)CCl)c(OC)c1OC |
| InChI | InChI=1S/C14H20ClNO4/c1-9(7-15)8-16-14(17)10-5-6-11(18-2)13(20-4)12(10)19-3/h5-6,9H,7-8H2,1-4H3,(H,16,17) |
| InChIKey | HYBWIDXVHDGNRC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|