C23H33NO5 — CID 7322140
N-[(2S)-2-(1-adamantyloxy)propyl]-2,3,4-trimethoxybenzamide (PubChem CID 7322140) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is N-[(2S)-2-(1-adamantyloxy)propyl]-2,3,4-trimethoxybenzamide.
| Compound Name | N-[(2S)-2-(1-adamantyloxy)propyl]-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 7322140 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | N-[(2S)-2-(1-adamantyloxy)propyl]-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC[C@H](C)OC23CC4CC(CC(C4)C2)C3)c(OC)c1OC |
| InChI | InChI=1S/C23H33NO5/c1-14(29-23-10-15-7-16(11-23)9-17(8-15)12-23)13-24-22(25)18-5-6-19(26-2)21(28-4)20(18)27-3/h5-6,14-17H,7-13H2,1-4H3,(H,24,25)/t14-,15?,16?,17?,23?/m0/s1 |
| InChIKey | APQBNQDTWHNATD-NSDYXAQKSA-N |
| XLogP | 3.82 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |