C27H33NO2 — CID 4916655
N-[2-(1-adamantyloxy)propyl]-2,2-diphenylacetamide (PubChem CID 4916655) has the molecular formula C27H33NO2 and a molecular weight of 403.57 g/mol. Its IUPAC name is N-[2-(1-adamantyloxy)propyl]-2,2-diphenylacetamide.
| Compound Name | N-[2-(1-adamantyloxy)propyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 4916655 |
| Molecular Formula | C27H33NO2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | N-[2-(1-adamantyloxy)propyl]-2,2-diphenylacetamide |
| SMILES | CC(CNC(=O)C(c1ccccc1)c1ccccc1)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H33NO2/c1-19(30-27-15-20-12-21(16-27)14-22(13-20)17-27)18-28-26(29)25(23-8-4-2-5-9-23)24-10-6-3-7-11-24/h2-11,19-22,25H,12-18H2,1H3,(H,28,29) |
| InChIKey | QQTSWTSOISODCW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |