C26H29NO3 — CID 7090694
(2R)-2-(1-adamantyl)-2-[(2,2-diphenylacetyl)amino]acetic acid (PubChem CID 7090694) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is (2R)-2-(1-adamantyl)-2-[(2,2-diphenylacetyl)amino]acetic acid.
| Compound Name | (2R)-2-(1-adamantyl)-2-[(2,2-diphenylacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 7090694 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (2R)-2-(1-adamantyl)-2-[(2,2-diphenylacetyl)amino]acetic acid |
| SMILES | O=C(N[C@@H](C(=O)O)C12CC3CC(CC(C3)C1)C2)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29NO3/c28-24(22(20-7-3-1-4-8-20)21-9-5-2-6-10-21)27-23(25(29)30)26-14-17-11-18(15-26)13-19(12-17)16-26/h1-10,17-19,22-23H,11-16H2,(H,27,28)(H,29,30)/t17?,18?,19?,23-,26?/m0/s1 |
| InChIKey | OTCJPZJTUKWAFA-MHLWUJJFSA-N |
| XLogP | 4.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |