C17H21NO3S — CID 7065356
(2S)-2-(1-adamantyl)-2-(thiophene-2-carbonylamino)acetic acid (PubChem CID 7065356) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is (2S)-2-(1-adamantyl)-2-(thiophene-2-carbonylamino)acetic acid.
| Compound Name | (2S)-2-(1-adamantyl)-2-(thiophene-2-carbonylamino)acetic acid |
|---|---|
| PubChem CID | 7065356 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (2S)-2-(1-adamantyl)-2-(thiophene-2-carbonylamino)acetic acid |
| SMILES | O=C(N[C@H](C(=O)O)C12CC3CC(CC(C3)C1)C2)c1cccs1 |
| InChI | InChI=1S/C17H21NO3S/c19-15(13-2-1-3-22-13)18-14(16(20)21)17-7-10-4-11(8-17)6-12(5-10)9-17/h1-3,10-12,14H,4-9H2,(H,18,19)(H,20,21)/t10?,11?,12?,14-,17?/m1/s1 |
| InChIKey | YLIATHIMWAKTQI-HSVOFOGUSA-N |
| XLogP | 3.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |