C9H9NO5S — CID 18517511
2-(thiophene-2-carbonylamino)butanedioic acid (PubChem CID 18517511) has the molecular formula C9H9NO5S and a molecular weight of 243.24 g/mol. Its IUPAC name is 2-(thiophene-2-carbonylamino)butanedioic acid.
| Compound Name | 2-(thiophene-2-carbonylamino)butanedioic acid |
|---|---|
| PubChem CID | 18517511 |
| Molecular Formula | C9H9NO5S |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 2-(thiophene-2-carbonylamino)butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)c1cccs1)C(=O)O |
| InChI | InChI=1S/C9H9NO5S/c11-7(12)4-5(9(14)15)10-8(13)6-2-1-3-16-6/h1-3,5H,4H2,(H,10,13)(H,11,12)(H,14,15) |
| InChIKey | HOIHNBFYAMTVJV-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |