C9H8BrNO5S — CID 78910337
2-[(5-bromothiophene-2-carbonyl)amino]butanedioic acid (PubChem CID 78910337) has the molecular formula C9H8BrNO5S and a molecular weight of 322.14 g/mol. Its IUPAC name is 2-[(5-bromothiophene-2-carbonyl)amino]butanedioic acid.
| Compound Name | 2-[(5-bromothiophene-2-carbonyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 78910337 |
| Molecular Formula | C9H8BrNO5S |
| Molecular Weight | 322.14 g/mol |
| Exact Mass | 320.93 |
| IUPAC Name | 2-[(5-bromothiophene-2-carbonyl)amino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)c1ccc(Br)s1)C(=O)O |
| InChI | InChI=1S/C9H8BrNO5S/c10-6-2-1-5(17-6)8(14)11-4(9(15)16)3-7(12)13/h1-2,4H,3H2,(H,11,14)(H,12,13)(H,15,16) |
| InChIKey | LZGNNMDJUVAJND-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.14 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |