C15H14BrNO3S — CID 104983214
(2S)-2-[(5-bromothiophene-2-carbonyl)amino]-4-phenylbutanoic acid (PubChem CID 104983214) has the molecular formula C15H14BrNO3S and a molecular weight of 368.25 g/mol. Its IUPAC name is (2S)-2-[(5-bromothiophene-2-carbonyl)amino]-4-phenylbutanoic acid.
| Compound Name | (2S)-2-[(5-bromothiophene-2-carbonyl)amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 104983214 |
| Molecular Formula | C15H14BrNO3S |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | (2S)-2-[(5-bromothiophene-2-carbonyl)amino]-4-phenylbutanoic acid |
| SMILES | O=C(N[C@@H](CCc1ccccc1)C(=O)O)c1ccc(Br)s1 |
| InChI | InChI=1S/C15H14BrNO3S/c16-13-9-8-12(21-13)14(18)17-11(15(19)20)7-6-10-4-2-1-3-5-10/h1-5,8-9,11H,6-7H2,(H,17,18)(H,19,20)/t11-/m0/s1 |
| InChIKey | VKNONZHKHLYLLW-NSHDSACASA-N |
| XLogP | 3.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |