C9H8BrNO6 — CID 106851139
(2R)-2-[(2-bromofuran-3-carbonyl)amino]butanedioic acid (PubChem CID 106851139) has the molecular formula C9H8BrNO6 and a molecular weight of 306.07 g/mol. Its IUPAC name is (2R)-2-[(2-bromofuran-3-carbonyl)amino]butanedioic acid.
| Compound Name | (2R)-2-[(2-bromofuran-3-carbonyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 106851139 |
| Molecular Formula | C9H8BrNO6 |
| Molecular Weight | 306.07 g/mol |
| Exact Mass | 304.95 |
| IUPAC Name | (2R)-2-[(2-bromofuran-3-carbonyl)amino]butanedioic acid |
| SMILES | O=C(O)C[C@@H](NC(=O)c1ccoc1Br)C(=O)O |
| InChI | InChI=1S/C9H8BrNO6/c10-7-4(1-2-17-7)8(14)11-5(9(15)16)3-6(12)13/h1-2,5H,3H2,(H,11,14)(H,12,13)(H,15,16)/t5-/m1/s1 |
| InChIKey | DGJUVRXVJMFJFD-RXMQYKEDSA-N |
| XLogP | 0.70 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.07 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |