C10H12BrNO6S — CID 106850886
2-[(2-bromofuran-3-carbonyl)amino]-4-methylsulfonylbutanoic acid (PubChem CID 106850886) has the molecular formula C10H12BrNO6S and a molecular weight of 354.18 g/mol. Its IUPAC name is 2-[(2-bromofuran-3-carbonyl)amino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[(2-bromofuran-3-carbonyl)amino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 106850886 |
| Molecular Formula | C10H12BrNO6S |
| Molecular Weight | 354.18 g/mol |
| Exact Mass | 352.96 |
| IUPAC Name | 2-[(2-bromofuran-3-carbonyl)amino]-4-methylsulfonylbutanoic acid |
| SMILES | CS(=O)(=O)CCC(NC(=O)c1ccoc1Br)C(=O)O |
| InChI | InChI=1S/C10H12BrNO6S/c1-19(16,17)5-3-7(10(14)15)12-9(13)6-2-4-18-8(6)11/h2,4,7H,3,5H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | MZHNQNKFRMNFQE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.18 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |