C11H13NO7S — CID 43107275
4-methylsulfonyl-2-[(6-oxopyran-3-carbonyl)amino]butanoic acid (PubChem CID 43107275) has the molecular formula C11H13NO7S and a molecular weight of 303.29 g/mol. Its IUPAC name is 4-methylsulfonyl-2-[(6-oxopyran-3-carbonyl)amino]butanoic acid.
| Compound Name | 4-methylsulfonyl-2-[(6-oxopyran-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 43107275 |
| Molecular Formula | C11H13NO7S |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 4-methylsulfonyl-2-[(6-oxopyran-3-carbonyl)amino]butanoic acid |
| SMILES | CS(=O)(=O)CCC(NC(=O)c1ccc(=O)oc1)C(=O)O |
| InChI | InChI=1S/C11H13NO7S/c1-20(17,18)5-4-8(11(15)16)12-10(14)7-2-3-9(13)19-6-7/h2-3,6,8H,4-5H2,1H3,(H,12,14)(H,15,16) |
| InChIKey | FTXJWEOQWRCWLS-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |