C12H17NO6S2 — CID 43358779
2-[[5-(methylsulfanylmethyl)furan-2-carbonyl]amino]-4-methylsulfonylbutanoic acid (PubChem CID 43358779) has the molecular formula C12H17NO6S2 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-[[5-(methylsulfanylmethyl)furan-2-carbonyl]amino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[[5-(methylsulfanylmethyl)furan-2-carbonyl]amino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 43358779 |
| Molecular Formula | C12H17NO6S2 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2-[[5-(methylsulfanylmethyl)furan-2-carbonyl]amino]-4-methylsulfonylbutanoic acid |
| SMILES | CSCc1ccc(C(=O)NC(CCS(C)(=O)=O)C(=O)O)o1 |
| InChI | InChI=1S/C12H17NO6S2/c1-20-7-8-3-4-10(19-8)11(14)13-9(12(15)16)5-6-21(2,17)18/h3-4,9H,5-7H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | BNRUGLKNZSZLPE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |