C12H15NO6S — CID 60830807
2-[[5-(methylsulfanylmethyl)furan-2-carbonyl]amino]pentanedioic acid (PubChem CID 60830807) has the molecular formula C12H15NO6S and a molecular weight of 301.32 g/mol. Its IUPAC name is 2-[[5-(methylsulfanylmethyl)furan-2-carbonyl]amino]pentanedioic acid.
| Compound Name | 2-[[5-(methylsulfanylmethyl)furan-2-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 60830807 |
| Molecular Formula | C12H15NO6S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2-[[5-(methylsulfanylmethyl)furan-2-carbonyl]amino]pentanedioic acid |
| SMILES | CSCc1ccc(C(=O)NC(CCC(=O)O)C(=O)O)o1 |
| InChI | InChI=1S/C12H15NO6S/c1-20-6-7-2-4-9(19-7)11(16)13-8(12(17)18)3-5-10(14)15/h2,4,8H,3,5-6H2,1H3,(H,13,16)(H,14,15)(H,17,18) |
| InChIKey | ZQRZTZPVKGAYDU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |