C11H13F2NO4S — CID 43469217
2-[[5-(difluoromethylsulfanylmethyl)furan-2-carbonyl]amino]butanoic acid (PubChem CID 43469217) has the molecular formula C11H13F2NO4S and a molecular weight of 293.29 g/mol. Its IUPAC name is 2-[[5-(difluoromethylsulfanylmethyl)furan-2-carbonyl]amino]butanoic acid.
| Compound Name | 2-[[5-(difluoromethylsulfanylmethyl)furan-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43469217 |
| Molecular Formula | C11H13F2NO4S |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-[[5-(difluoromethylsulfanylmethyl)furan-2-carbonyl]amino]butanoic acid |
| SMILES | CCC(NC(=O)c1ccc(CSC(F)F)o1)C(=O)O |
| InChI | InChI=1S/C11H13F2NO4S/c1-2-7(10(16)17)14-9(15)8-4-3-6(18-8)5-19-11(12)13/h3-4,7,11H,2,5H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | QVSXAJJTYMLFOI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |