C8H9F2NO3S — CID 60735591
5-(difluoromethylsulfanylmethyl)-N-methoxyfuran-2-carboxamide (PubChem CID 60735591) has the molecular formula C8H9F2NO3S and a molecular weight of 237.23 g/mol. Its IUPAC name is 5-(difluoromethylsulfanylmethyl)-N-methoxyfuran-2-carboxamide.
| Compound Name | 5-(difluoromethylsulfanylmethyl)-N-methoxyfuran-2-carboxamide |
|---|---|
| PubChem CID | 60735591 |
| Molecular Formula | C8H9F2NO3S |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 5-(difluoromethylsulfanylmethyl)-N-methoxyfuran-2-carboxamide |
| SMILES | CONC(=O)c1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C8H9F2NO3S/c1-13-11-7(12)6-3-2-5(14-6)4-15-8(9)10/h2-3,8H,4H2,1H3,(H,11,12) |
| InChIKey | HPPRLUIAFQHHAB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|