C7H8F2N2O2S — CID 43244787
5-(difluoromethylsulfanylmethyl)furan-2-carbohydrazide (PubChem CID 43244787) has the molecular formula C7H8F2N2O2S and a molecular weight of 222.22 g/mol. Its IUPAC name is 5-(difluoromethylsulfanylmethyl)furan-2-carbohydrazide.
| Compound Name | 5-(difluoromethylsulfanylmethyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 43244787 |
| Molecular Formula | C7H8F2N2O2S |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 5-(difluoromethylsulfanylmethyl)furan-2-carbohydrazide |
| SMILES | NNC(=O)c1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C7H8F2N2O2S/c8-7(9)14-3-4-1-2-5(13-4)6(12)11-10/h1-2,7H,3,10H2,(H,11,12) |
| InChIKey | OHKUBCQOLGGHMT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|