C12H17F2NO3S — CID 115968835
5-(difluoromethylsulfanylmethyl)-N-(4-hydroxy-2-methylbutan-2-yl)furan-2-carboxamide (PubChem CID 115968835) has the molecular formula C12H17F2NO3S and a molecular weight of 293.33 g/mol. Its IUPAC name is 5-(difluoromethylsulfanylmethyl)-N-(4-hydroxy-2-methylbutan-2-yl)furan-2-carboxamide.
| Compound Name | 5-(difluoromethylsulfanylmethyl)-N-(4-hydroxy-2-methylbutan-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 115968835 |
| Molecular Formula | C12H17F2NO3S |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 5-(difluoromethylsulfanylmethyl)-N-(4-hydroxy-2-methylbutan-2-yl)furan-2-carboxamide |
| SMILES | CC(C)(CCO)NC(=O)c1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C12H17F2NO3S/c1-12(2,5-6-16)15-10(17)9-4-3-8(18-9)7-19-11(13)14/h3-4,11,16H,5-7H2,1-2H3,(H,15,17) |
| InChIKey | TUMSQDQYCRDWPH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |