C9H9F2NO4S — CID 43354351
2-[[5-(difluoromethylsulfanylmethyl)furan-2-carbonyl]amino]acetic acid (PubChem CID 43354351) has the molecular formula C9H9F2NO4S and a molecular weight of 265.24 g/mol. Its IUPAC name is 2-[[5-(difluoromethylsulfanylmethyl)furan-2-carbonyl]amino]acetic acid.
| Compound Name | 2-[[5-(difluoromethylsulfanylmethyl)furan-2-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 43354351 |
| Molecular Formula | C9H9F2NO4S |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 2-[[5-(difluoromethylsulfanylmethyl)furan-2-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C9H9F2NO4S/c10-9(11)17-4-5-1-2-6(16-5)8(15)12-3-7(13)14/h1-2,9H,3-4H2,(H,12,15)(H,13,14) |
| InChIKey | UMQFBGVRCVXLEQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |