C12H13F2N3O2S — CID 115668500
5-(difluoromethylsulfanylmethyl)-N-[2-(1H-imidazol-2-yl)ethyl]furan-2-carboxamide (PubChem CID 115668500) has the molecular formula C12H13F2N3O2S and a molecular weight of 301.32 g/mol. Its IUPAC name is 5-(difluoromethylsulfanylmethyl)-N-[2-(1H-imidazol-2-yl)ethyl]furan-2-carboxamide.
| Compound Name | 5-(difluoromethylsulfanylmethyl)-N-[2-(1H-imidazol-2-yl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 115668500 |
| Molecular Formula | C12H13F2N3O2S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 5-(difluoromethylsulfanylmethyl)-N-[2-(1H-imidazol-2-yl)ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCc1ncc[nH]1)c1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C12H13F2N3O2S/c13-12(14)20-7-8-1-2-9(19-8)11(18)17-4-3-10-15-5-6-16-10/h1-2,5-6,12H,3-4,7H2,(H,15,16)(H,17,18) |
| InChIKey | GEMUBGFQUGEAPQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |