C12H13F2NO4S — CID 79257404
2-[[5-(difluoromethylsulfanylmethyl)furan-2-carbonyl]-prop-2-enylamino]acetic acid (PubChem CID 79257404) has the molecular formula C12H13F2NO4S and a molecular weight of 305.30 g/mol. Its IUPAC name is 2-[[5-(difluoromethylsulfanylmethyl)furan-2-carbonyl]-prop-2-enylamino]acetic acid.
| Compound Name | 2-[[5-(difluoromethylsulfanylmethyl)furan-2-carbonyl]-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79257404 |
| Molecular Formula | C12H13F2NO4S |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-[[5-(difluoromethylsulfanylmethyl)furan-2-carbonyl]-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)C(=O)c1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C12H13F2NO4S/c1-2-5-15(6-10(16)17)11(18)9-4-3-8(19-9)7-20-12(13)14/h2-4,12H,1,5-7H2,(H,16,17) |
| InChIKey | NNQCLGJRGLQUQS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|