C7H8F2O2S — CID 43753545
[5-(difluoromethylsulfanylmethyl)furan-2-yl]methanol (PubChem CID 43753545) has the molecular formula C7H8F2O2S and a molecular weight of 194.20 g/mol. Its IUPAC name is [5-(difluoromethylsulfanylmethyl)furan-2-yl]methanol.
| Compound Name | [5-(difluoromethylsulfanylmethyl)furan-2-yl]methanol |
|---|---|
| PubChem CID | 43753545 |
| Molecular Formula | C7H8F2O2S |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | [5-(difluoromethylsulfanylmethyl)furan-2-yl]methanol |
| SMILES | OCc1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C7H8F2O2S/c8-7(9)12-4-6-2-1-5(3-10)11-6/h1-2,7,10H,3-4H2 |
| InChIKey | MCIBIMVPNZMDGX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |