C10H15F2NO2S — CID 43776345
2-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]propan-1-ol (PubChem CID 43776345) has the molecular formula C10H15F2NO2S and a molecular weight of 251.30 g/mol. Its IUPAC name is 2-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]propan-1-ol.
| Compound Name | 2-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]propan-1-ol |
|---|---|
| PubChem CID | 43776345 |
| Molecular Formula | C10H15F2NO2S |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]propan-1-ol |
| SMILES | CC(CO)NCc1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C10H15F2NO2S/c1-7(5-14)13-4-8-2-3-9(15-8)6-16-10(11)12/h2-3,7,10,13-14H,4-6H2,1H3 |
| InChIKey | ZYYQPOSOBAADMH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |