C15H16BrF2NOS — CID 43225293
1-(2-bromophenyl)-N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]ethanamine (PubChem CID 43225293) has the molecular formula C15H16BrF2NOS and a molecular weight of 376.27 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]ethanamine.
| Compound Name | 1-(2-bromophenyl)-N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 43225293 |
| Molecular Formula | C15H16BrF2NOS |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 1-(2-bromophenyl)-N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]ethanamine |
| SMILES | CC(NCc1ccc(CSC(F)F)o1)c1ccccc1Br |
| InChI | InChI=1S/C15H16BrF2NOS/c1-10(13-4-2-3-5-14(13)16)19-8-11-6-7-12(20-11)9-21-15(17)18/h2-7,10,15,19H,8-9H2,1H3 |
| InChIKey | KRQDHQAGCUJMOA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |