C8H11F2NO2S — CID 82706312
1-[5-(difluoromethylsulfanylmethyl)furan-2-yl]-N-methoxymethanamine (PubChem CID 82706312) has the molecular formula C8H11F2NO2S and a molecular weight of 223.24 g/mol. Its IUPAC name is 1-[5-(difluoromethylsulfanylmethyl)furan-2-yl]-N-methoxymethanamine.
| Compound Name | 1-[5-(difluoromethylsulfanylmethyl)furan-2-yl]-N-methoxymethanamine |
|---|---|
| PubChem CID | 82706312 |
| Molecular Formula | C8H11F2NO2S |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 1-[5-(difluoromethylsulfanylmethyl)furan-2-yl]-N-methoxymethanamine |
| SMILES | CONCc1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C8H11F2NO2S/c1-12-11-4-6-2-3-7(13-6)5-14-8(9)10/h2-3,8,11H,4-5H2,1H3 |
| InChIKey | UUBSUISSGRIRPH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|