C11H17F2NO2S — CID 113492063
1-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]butan-2-ol (PubChem CID 113492063) has the molecular formula C11H17F2NO2S and a molecular weight of 265.32 g/mol. Its IUPAC name is 1-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]butan-2-ol.
| Compound Name | 1-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]butan-2-ol |
|---|---|
| PubChem CID | 113492063 |
| Molecular Formula | C11H17F2NO2S |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 1-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]butan-2-ol |
| SMILES | CCC(O)CNCc1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C11H17F2NO2S/c1-2-8(15)5-14-6-9-3-4-10(16-9)7-17-11(12)13/h3-4,8,11,14-15H,2,5-7H2,1H3 |
| InChIKey | GRQHPIBJZARNRQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |